C17H21N7O — CID 169374677
5-[3-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine (PubChem CID 169374677) has the molecular formula C17H21N7O and a molecular weight of 339.40 g/mol. Its IUPAC name is 5-[3-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine.
| Compound Name | 5-[3-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
|---|---|
| PubChem CID | 169374677 |
| Molecular Formula | C17H21N7O |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 5-[3-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
| SMILES | Cc1nnc(-c2cccc(N3C(N)=NC(N)=NC34CCCCC4)c2)o1 |
| InChI | InChI=1S/C17H21N7O/c1-11-22-23-14(25-11)12-6-5-7-13(10-12)24-16(19)20-15(18)21-17(24)8-3-2-4-9-17/h5-7,10H,2-4,8-9H2,1H3,(H4,18,19,20,21) |
| InChIKey | YAHJHMDFNWCGPR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 118.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |