C18H24N8O2 — CID 169377651
4-[3-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)phenyl]-1,2-dimethyl-1,2,4-triazolidine-3,5-dione (PubChem CID 169377651) has the molecular formula C18H24N8O2 and a molecular weight of 384.44 g/mol. Its IUPAC name is 4-[3-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)phenyl]-1,2-dimethyl-1,2,4-triazolidine-3,5-dione.
| Compound Name | 4-[3-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)phenyl]-1,2-dimethyl-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 169377651 |
| Molecular Formula | C18H24N8O2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 4-[3-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)phenyl]-1,2-dimethyl-1,2,4-triazolidine-3,5-dione |
| SMILES | Cn1c(=O)n(-c2cccc(N3C(N)=NC(N)=NC34CCCCC4)c2)c(=O)n1C |
| InChI | InChI=1S/C18H24N8O2/c1-23-16(27)25(17(28)24(23)2)12-7-6-8-13(11-12)26-15(20)21-14(19)22-18(26)9-4-3-5-10-18/h6-8,11H,3-5,9-10H2,1-2H3,(H4,19,20,21,22) |
| InChIKey | QLXGIDHEAHGVBP-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 128.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |