C23H28N6O — CID 169374546
3-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-N-(3,4-dimethylphenyl)benzamide (PubChem CID 169374546) has the molecular formula C23H28N6O and a molecular weight of 404.52 g/mol. Its IUPAC name is 3-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-N-(3,4-dimethylphenyl)benzamide.
| Compound Name | 3-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-N-(3,4-dimethylphenyl)benzamide |
|---|---|
| PubChem CID | 169374546 |
| Molecular Formula | C23H28N6O |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | 3-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-N-(3,4-dimethylphenyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2cccc(N3C(N)=NC(N)=NC34CCCCC4)c2)cc1C |
| InChI | InChI=1S/C23H28N6O/c1-15-9-10-18(13-16(15)2)26-20(30)17-7-6-8-19(14-17)29-22(25)27-21(24)28-23(29)11-4-3-5-12-23/h6-10,13-14H,3-5,11-12H2,1-2H3,(H,26,30)(H4,24,25,27,28) |
| InChIKey | JDBKECLUPRRPFS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 109.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |