C19H26N6O — CID 169376401
6-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-1,3,3-trimethylindol-2-one (PubChem CID 169376401) has the molecular formula C19H26N6O and a molecular weight of 354.46 g/mol. Its IUPAC name is 6-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-1,3,3-trimethylindol-2-one.
| Compound Name | 6-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-1,3,3-trimethylindol-2-one |
|---|---|
| PubChem CID | 169376401 |
| Molecular Formula | C19H26N6O |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 6-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-1,3,3-trimethylindol-2-one |
| SMILES | CN1C(=O)C(C)(C)c2ccc(N3C(N)=NC(N)=NC34CCCCC4)cc21 |
| InChI | InChI=1S/C19H26N6O/c1-18(2)13-8-7-12(11-14(13)24(3)15(18)26)25-17(21)22-16(20)23-19(25)9-5-4-6-10-19/h7-8,11H,4-6,9-10H2,1-3H3,(H4,20,21,22,23) |
| InChIKey | VGLWYIXIHXNILO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 100.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |