C18H24N6O2 — CID 169375723
7-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-4-methyl-2,3-dihydro-1,4-benzoxazepin-5-one (PubChem CID 169375723) has the molecular formula C18H24N6O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is 7-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-4-methyl-2,3-dihydro-1,4-benzoxazepin-5-one.
| Compound Name | 7-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-4-methyl-2,3-dihydro-1,4-benzoxazepin-5-one |
|---|---|
| PubChem CID | 169375723 |
| Molecular Formula | C18H24N6O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 7-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-4-methyl-2,3-dihydro-1,4-benzoxazepin-5-one |
| SMILES | CN1CCOc2ccc(N3C(N)=NC(N)=NC34CCCCC4)cc2C1=O |
| InChI | InChI=1S/C18H24N6O2/c1-23-9-10-26-14-6-5-12(11-13(14)15(23)25)24-17(20)21-16(19)22-18(24)7-3-2-4-8-18/h5-6,11H,2-4,7-10H2,1H3,(H4,19,20,21,22) |
| InChIKey | NPLJLRHHDHJLNA-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |