C20H30BN5O2 — CID 169373762
5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine (PubChem CID 169373762) has the molecular formula C20H30BN5O2 and a molecular weight of 383.31 g/mol. Its IUPAC name is 5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine.
| Compound Name | 5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
|---|---|
| PubChem CID | 169373762 |
| Molecular Formula | C20H30BN5O2 |
| Molecular Weight | 383.31 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | 5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
| SMILES | CC1(C)OB(c2ccc(N3C(N)=NC(N)=NC34CCCCC4)cc2)OC1(C)C |
| InChI | InChI=1S/C20H30BN5O2/c1-18(2)19(3,4)28-21(27-18)14-8-10-15(11-9-14)26-17(23)24-16(22)25-20(26)12-6-5-7-13-20/h8-11H,5-7,12-13H2,1-4H3,(H4,22,23,24,25) |
| InChIKey | TVRDTXWTIYFQAV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|