C21H29BN6O2 — CID 169375768
3-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (PubChem CID 169375768) has the molecular formula C21H29BN6O2 and a molecular weight of 408.32 g/mol. Its IUPAC name is 3-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile.
| Compound Name | 3-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
|---|---|
| PubChem CID | 169375768 |
| Molecular Formula | C21H29BN6O2 |
| Molecular Weight | 408.32 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 3-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| SMILES | CC1(C)OB(c2cc(C#N)cc(N3C(N)=NC(N)=NC34CCCCC4)c2)OC1(C)C |
| InChI | InChI=1S/C21H29BN6O2/c1-19(2)20(3,4)30-22(29-19)15-10-14(13-23)11-16(12-15)28-18(25)26-17(24)27-21(28)8-6-5-7-9-21/h10-12H,5-9H2,1-4H3,(H4,24,25,26,27) |
| InChIKey | PUAHFMCRHLQFQN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 122.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|