C19H26N6O — CID 169377472
6-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-4,4-dimethyl-1,2-dihydroisoquinolin-3-one (PubChem CID 169377472) has the molecular formula C19H26N6O and a molecular weight of 354.46 g/mol. Its IUPAC name is 6-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-4,4-dimethyl-1,2-dihydroisoquinolin-3-one.
| Compound Name | 6-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-4,4-dimethyl-1,2-dihydroisoquinolin-3-one |
|---|---|
| PubChem CID | 169377472 |
| Molecular Formula | C19H26N6O |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 6-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-4,4-dimethyl-1,2-dihydroisoquinolin-3-one |
| SMILES | CC1(C)C(=O)NCc2ccc(N3C(N)=NC(N)=NC34CCCCC4)cc21 |
| InChI | InChI=1S/C19H26N6O/c1-18(2)14-10-13(7-6-12(14)11-22-15(18)26)25-17(21)23-16(20)24-19(25)8-4-3-5-9-19/h6-7,10H,3-5,8-9,11H2,1-2H3,(H,22,26)(H4,20,21,23,24) |
| InChIKey | JXGPYALBTBFKHQ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 109.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |