C19H24N6OS — CID 169375125
5-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-N,N-dimethyl-1-benzothiophene-2-carboxamide (PubChem CID 169375125) has the molecular formula C19H24N6OS and a molecular weight of 384.51 g/mol. Its IUPAC name is 5-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-N,N-dimethyl-1-benzothiophene-2-carboxamide.
| Compound Name | 5-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-N,N-dimethyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 169375125 |
| Molecular Formula | C19H24N6OS |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 5-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-N,N-dimethyl-1-benzothiophene-2-carboxamide |
| SMILES | CN(C)C(=O)c1cc2cc(N3C(N)=NC(N)=NC34CCCCC4)ccc2s1 |
| InChI | InChI=1S/C19H24N6OS/c1-24(2)16(26)15-11-12-10-13(6-7-14(12)27-15)25-18(21)22-17(20)23-19(25)8-4-3-5-9-19/h6-7,10-11H,3-5,8-9H2,1-2H3,(H4,20,21,22,23) |
| InChIKey | RFQHATZXBMUIHZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 100.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |