C16H16ClF4N5O2 — CID 169376157
5-(6-chloro-2,2,3,3-tetrafluoro-1,4-benzodioxin-7-yl)-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine (PubChem CID 169376157) has the molecular formula C16H16ClF4N5O2 and a molecular weight of 421.78 g/mol. Its IUPAC name is 5-(6-chloro-2,2,3,3-tetrafluoro-1,4-benzodioxin-7-yl)-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine.
| Compound Name | 5-(6-chloro-2,2,3,3-tetrafluoro-1,4-benzodioxin-7-yl)-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
|---|---|
| PubChem CID | 169376157 |
| Molecular Formula | C16H16ClF4N5O2 |
| Molecular Weight | 421.78 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 5-(6-chloro-2,2,3,3-tetrafluoro-1,4-benzodioxin-7-yl)-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
| SMILES | NC1=NC2(CCCCC2)N(c2cc3c(cc2Cl)OC(F)(F)C(F)(F)O3)C(N)=N1 |
| InChI | InChI=1S/C16H16ClF4N5O2/c17-8-6-10-11(28-16(20,21)15(18,19)27-10)7-9(8)26-13(23)24-12(22)25-14(26)4-2-1-3-5-14/h6-7H,1-5H2,(H4,22,23,24,25) |
| InChIKey | GHVPCDAUVCRXLH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.78 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|