C14H16ClFIN5 — CID 169377929
5-(2-chloro-4-fluoro-5-iodophenyl)-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine (PubChem CID 169377929) has the molecular formula C14H16ClFIN5 and a molecular weight of 435.67 g/mol. Its IUPAC name is 5-(2-chloro-4-fluoro-5-iodophenyl)-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine.
| Compound Name | 5-(2-chloro-4-fluoro-5-iodophenyl)-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
|---|---|
| PubChem CID | 169377929 |
| Molecular Formula | C14H16ClFIN5 |
| Molecular Weight | 435.67 g/mol |
| Exact Mass | 435.01 |
| IUPAC Name | 5-(2-chloro-4-fluoro-5-iodophenyl)-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
| SMILES | NC1=NC2(CCCCC2)N(c2cc(I)c(F)cc2Cl)C(N)=N1 |
| InChI | InChI=1S/C14H16ClFIN5/c15-8-6-9(16)10(17)7-11(8)22-13(19)20-12(18)21-14(22)4-2-1-3-5-14/h6-7H,1-5H2,(H4,18,19,20,21) |
| InChIKey | DIJBBWCBIIVOMR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.67 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|