C15H18N6O4 — CID 169374112
3-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-5-nitrobenzoic acid (PubChem CID 169374112) has the molecular formula C15H18N6O4 and a molecular weight of 346.35 g/mol. Its IUPAC name is 3-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-5-nitrobenzoic acid.
| Compound Name | 3-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 169374112 |
| Molecular Formula | C15H18N6O4 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 3-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-5-nitrobenzoic acid |
| SMILES | NC1=NC2(CCCCC2)N(c2cc(C(=O)O)cc([N+](=O)[O-])c2)C(N)=N1 |
| InChI | InChI=1S/C15H18N6O4/c16-13-18-14(17)20(15(19-13)4-2-1-3-5-15)10-6-9(12(22)23)7-11(8-10)21(24)25/h6-8H,1-5H2,(H,22,23)(H4,16,17,18,19) |
| InChIKey | WKTDPALHDRVXHY-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 160.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|