C16H21Br2N5 — CID 169374409
5-(4,6-dibromo-2,3-dimethylphenyl)-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine (PubChem CID 169374409) has the molecular formula C16H21Br2N5 and a molecular weight of 443.19 g/mol. Its IUPAC name is 5-(4,6-dibromo-2,3-dimethylphenyl)-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine.
| Compound Name | 5-(4,6-dibromo-2,3-dimethylphenyl)-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
|---|---|
| PubChem CID | 169374409 |
| Molecular Formula | C16H21Br2N5 |
| Molecular Weight | 443.19 g/mol |
| Exact Mass | 441.02 |
| IUPAC Name | 5-(4,6-dibromo-2,3-dimethylphenyl)-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
| SMILES | Cc1c(Br)cc(Br)c(N2C(N)=NC(N)=NC23CCCCC3)c1C |
| InChI | InChI=1S/C16H21Br2N5/c1-9-10(2)13(12(18)8-11(9)17)23-15(20)21-14(19)22-16(23)6-4-3-5-7-16/h8H,3-7H2,1-2H3,(H4,19,20,21,22) |
| InChIKey | RDUIUSFGUNROMA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.19 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |