C15H17Br2N5O — CID 169378007
3,5-dibromo-2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)benzaldehyde (PubChem CID 169378007) has the molecular formula C15H17Br2N5O and a molecular weight of 443.14 g/mol. Its IUPAC name is 3,5-dibromo-2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)benzaldehyde.
| Compound Name | 3,5-dibromo-2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)benzaldehyde |
|---|---|
| PubChem CID | 169378007 |
| Molecular Formula | C15H17Br2N5O |
| Molecular Weight | 443.14 g/mol |
| Exact Mass | 440.98 |
| IUPAC Name | 3,5-dibromo-2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)benzaldehyde |
| SMILES | NC1=NC2(CCCCC2)N(c2c(Br)cc(Br)cc2C=O)C(N)=N1 |
| InChI | InChI=1S/C15H17Br2N5O/c16-10-6-9(8-23)12(11(17)7-10)22-14(19)20-13(18)21-15(22)4-2-1-3-5-15/h6-8H,1-5H2,(H4,18,19,20,21) |
| InChIKey | PNPGNWLXQDYWNH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.14 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|