C18H16F2N2O3S — CID 55671741
1-(5,7-difluoro-3,4-dihydro-2H-quinolin-1-yl)-2-(4-nitrophenyl)sulfanylpropan-1-one (PubChem CID 55671741) has the molecular formula C18H16F2N2O3S and a molecular weight of 378.40 g/mol. Its IUPAC name is 1-(5,7-difluoro-3,4-dihydro-2H-quinolin-1-yl)-2-(4-nitrophenyl)sulfanylpropan-1-one.
| Compound Name | 1-(5,7-difluoro-3,4-dihydro-2H-quinolin-1-yl)-2-(4-nitrophenyl)sulfanylpropan-1-one |
|---|---|
| PubChem CID | 55671741 |
| Molecular Formula | C18H16F2N2O3S |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 1-(5,7-difluoro-3,4-dihydro-2H-quinolin-1-yl)-2-(4-nitrophenyl)sulfanylpropan-1-one |
| SMILES | CC(Sc1ccc([N+](=O)[O-])cc1)C(=O)N1CCCc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C18H16F2N2O3S/c1-11(26-14-6-4-13(5-7-14)22(24)25)18(23)21-8-2-3-15-16(20)9-12(19)10-17(15)21/h4-7,9-11H,2-3,8H2,1H3 |
| InChIKey | ALBNWPJIRSXYGO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|