C16H23N3O3S — CID 56786194
1-(4-ethyl-1,4-diazepan-1-yl)-2-(4-nitrophenyl)sulfanylpropan-1-one (PubChem CID 56786194) has the molecular formula C16H23N3O3S and a molecular weight of 337.44 g/mol. Its IUPAC name is 1-(4-ethyl-1,4-diazepan-1-yl)-2-(4-nitrophenyl)sulfanylpropan-1-one.
| Compound Name | 1-(4-ethyl-1,4-diazepan-1-yl)-2-(4-nitrophenyl)sulfanylpropan-1-one |
|---|---|
| PubChem CID | 56786194 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 1-(4-ethyl-1,4-diazepan-1-yl)-2-(4-nitrophenyl)sulfanylpropan-1-one |
| SMILES | CCN1CCCN(C(=O)C(C)Sc2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C16H23N3O3S/c1-3-17-9-4-10-18(12-11-17)16(20)13(2)23-15-7-5-14(6-8-15)19(21)22/h5-8,13H,3-4,9-12H2,1-2H3 |
| InChIKey | MTTVFEFLCMAPBQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|