About (4,6-difluoro-2,3-dihydroindol-1-yl)-(4-nitro-1H-pyrazol-5-yl)methanone
(4,6-difluoro-2,3-dihydroindol-1-yl)-(4-nitro-1H-pyrazol-5-yl)methanone (PubChem CID 99834833) has the molecular formula C12H8F2N4O3
and a molecular weight of 294.22 g/mol. Its IUPAC name is (4,6-difluoro-2,3-dihydroindol-1-yl)-(4-nitro-1H-pyrazol-5-yl)methanone.
Molecular Properties
| Compound Name | (4,6-difluoro-2,3-dihydroindol-1-yl)-(4-nitro-1H-pyrazol-5-yl)methanone |
| PubChem CID | 99834833 |
| Molecular Formula | C12H8F2N4O3 |
| Molecular Weight | 294.22 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | (4,6-difluoro-2,3-dihydroindol-1-yl)-(4-nitro-1H-pyrazol-5-yl)methanone |
| SMILES | O=C(c1[nH]ncc1[N+](=O)[O-])N1CCc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C12H8F2N4O3/c13-6-3-8(14)7-1-2-17(9(7)4-6)12(19)11-10(18(20)21)5-15-16-11/h3-5H,1-2H2,(H,15,16) |
| InChIKey | DPJXVHHFUFZBCF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 92.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.22 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4,6-difluoro-2,3-dihydroindol-1-yl)-(4-nitro-1H-pyrazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,6-difluoro-2,3-dihydroindol-1-yl)-(4-nitro-1H-pyrazol-5-yl)methanone?
The IUPAC name of (4,6-difluoro-2,3-dihydroindol-1-yl)-(4-nitro-1H-pyrazol-5-yl)methanone (CID 99834833) is (4,6-difluoro-2,3-dihydroindol-1-yl)-(4-nitro-1H-pyrazol-5-yl)methanone.
What is the SMILES notation for (4,6-difluoro-2,3-dihydroindol-1-yl)-(4-nitro-1H-pyrazol-5-yl)methanone?
The canonical SMILES for (4,6-difluoro-2,3-dihydroindol-1-yl)-(4-nitro-1H-pyrazol-5-yl)methanone is O=C(c1[nH]ncc1[N+](=O)[O-])N1CCc2c(F)cc(F)cc21.
What is the InChIKey of (4,6-difluoro-2,3-dihydroindol-1-yl)-(4-nitro-1H-pyrazol-5-yl)methanone?
The InChIKey is DPJXVHHFUFZBCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8F2N4O3/c13-6-3-8(14)7-1-2-17(9(7)4-6)12(19)11-10(18(20)21)5-15-16-11/h3-5H,1-2H2,(H,15,16).
What are the key properties of (4,6-difluoro-2,3-dihydroindol-1-yl)-(4-nitro-1H-pyrazol-5-yl)methanone?
(4,6-difluoro-2,3-dihydroindol-1-yl)-(4-nitro-1H-pyrazol-5-yl)methanone has a molecular weight of 294.22 g/mol, XLogP of 1.80, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4,6-difluoro-2,3-dihydroindol-1-yl)-(4-nitro-1H-pyrazol-5-yl)methanone is sourced from PubChem (CID 99834833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).