C9H7F2NO2 — CID 175962184
4,6-difluoro-2,3-dihydroindole-1-carboxylic acid (PubChem CID 175962184) has the molecular formula C9H7F2NO2 and a molecular weight of 199.16 g/mol. Its IUPAC name is 4,6-difluoro-2,3-dihydroindole-1-carboxylic acid.
| Compound Name | 4,6-difluoro-2,3-dihydroindole-1-carboxylic acid |
|---|---|
| PubChem CID | 175962184 |
| Molecular Formula | C9H7F2NO2 |
| Molecular Weight | 199.16 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | 4,6-difluoro-2,3-dihydroindole-1-carboxylic acid |
| SMILES | O=C(O)N1CCc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C9H7F2NO2/c10-5-3-7(11)6-1-2-12(9(13)14)8(6)4-5/h3-4H,1-2H2,(H,13,14) |
| InChIKey | GRDJGDGIBRWQEA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.16 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |