About (4-bromo-2-fluorophenyl)-(4,6-difluoro-2,3-dihydroindol-1-yl)methanone
(4-bromo-2-fluorophenyl)-(4,6-difluoro-2,3-dihydroindol-1-yl)methanone (PubChem CID 112833947) has the molecular formula C15H9BrF3NO
and a molecular weight of 356.14 g/mol. Its IUPAC name is (4-bromo-2-fluorophenyl)-(4,6-difluoro-2,3-dihydroindol-1-yl)methanone.
Molecular Properties
| Compound Name | (4-bromo-2-fluorophenyl)-(4,6-difluoro-2,3-dihydroindol-1-yl)methanone |
| PubChem CID | 112833947 |
| Molecular Formula | C15H9BrF3NO |
| Molecular Weight | 356.14 g/mol |
| Exact Mass | 354.98 |
| IUPAC Name | (4-bromo-2-fluorophenyl)-(4,6-difluoro-2,3-dihydroindol-1-yl)methanone |
| SMILES | O=C(c1ccc(Br)cc1F)N1CCc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C15H9BrF3NO/c16-8-1-2-11(12(18)5-8)15(21)20-4-3-10-13(19)6-9(17)7-14(10)20/h1-2,5-7H,3-4H2 |
| InChIKey | OPPDPQHVDKOELN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.14 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4-bromo-2-fluorophenyl)-(4,6-difluoro-2,3-dihydroindol-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-2-fluorophenyl)-(4,6-difluoro-2,3-dihydroindol-1-yl)methanone?
The IUPAC name of (4-bromo-2-fluorophenyl)-(4,6-difluoro-2,3-dihydroindol-1-yl)methanone (CID 112833947) is (4-bromo-2-fluorophenyl)-(4,6-difluoro-2,3-dihydroindol-1-yl)methanone.
What is the SMILES notation for (4-bromo-2-fluorophenyl)-(4,6-difluoro-2,3-dihydroindol-1-yl)methanone?
The canonical SMILES for (4-bromo-2-fluorophenyl)-(4,6-difluoro-2,3-dihydroindol-1-yl)methanone is O=C(c1ccc(Br)cc1F)N1CCc2c(F)cc(F)cc21.
What is the InChIKey of (4-bromo-2-fluorophenyl)-(4,6-difluoro-2,3-dihydroindol-1-yl)methanone?
The InChIKey is OPPDPQHVDKOELN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9BrF3NO/c16-8-1-2-11(12(18)5-8)15(21)20-4-3-10-13(19)6-9(17)7-14(10)20/h1-2,5-7H,3-4H2.
What are the key properties of (4-bromo-2-fluorophenyl)-(4,6-difluoro-2,3-dihydroindol-1-yl)methanone?
(4-bromo-2-fluorophenyl)-(4,6-difluoro-2,3-dihydroindol-1-yl)methanone has a molecular weight of 356.14 g/mol, XLogP of 4.07, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-2-fluorophenyl)-(4,6-difluoro-2,3-dihydroindol-1-yl)methanone is sourced from PubChem (CID 112833947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).