C17H15F2N3O3 — CID 112833970
1-(4,6-difluoro-2,3-dihydroindol-1-yl)-3-(2-nitroanilino)propan-1-one (PubChem CID 112833970) has the molecular formula C17H15F2N3O3 and a molecular weight of 347.32 g/mol. Its IUPAC name is 1-(4,6-difluoro-2,3-dihydroindol-1-yl)-3-(2-nitroanilino)propan-1-one.
| Compound Name | 1-(4,6-difluoro-2,3-dihydroindol-1-yl)-3-(2-nitroanilino)propan-1-one |
|---|---|
| PubChem CID | 112833970 |
| Molecular Formula | C17H15F2N3O3 |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 1-(4,6-difluoro-2,3-dihydroindol-1-yl)-3-(2-nitroanilino)propan-1-one |
| SMILES | O=C(CCNc1ccccc1[N+](=O)[O-])N1CCc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C17H15F2N3O3/c18-11-9-13(19)12-6-8-21(16(12)10-11)17(23)5-7-20-14-3-1-2-4-15(14)22(24)25/h1-4,9-10,20H,5-8H2 |
| InChIKey | WADMKLFNXCJCBN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|