C21H20N4O8S — CID 3904068
4-ethoxy-N-[3-(4-ethoxy-3-nitrobenzoyl)-1,3-thiazolidin-2-ylidene]-3-nitrobenzamide (PubChem CID 3904068) has the molecular formula C21H20N4O8S and a molecular weight of 488.48 g/mol. Its IUPAC name is 4-ethoxy-N-[3-(4-ethoxy-3-nitrobenzoyl)-1,3-thiazolidin-2-ylidene]-3-nitrobenzamide.
| Compound Name | 4-ethoxy-N-[3-(4-ethoxy-3-nitrobenzoyl)-1,3-thiazolidin-2-ylidene]-3-nitrobenzamide |
|---|---|
| PubChem CID | 3904068 |
| Molecular Formula | C21H20N4O8S |
| Molecular Weight | 488.48 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | 4-ethoxy-N-[3-(4-ethoxy-3-nitrobenzoyl)-1,3-thiazolidin-2-ylidene]-3-nitrobenzamide |
| SMILES | CCOc1ccc(C(=O)/N=C2\SCCN2C(=O)c2ccc(OCC)c([N+](=O)[O-])c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H20N4O8S/c1-3-32-17-7-5-13(11-15(17)24(28)29)19(26)22-21-23(9-10-34-21)20(27)14-6-8-18(33-4-2)16(12-14)25(30)31/h5-8,11-12H,3-4,9-10H2,1-2H3/b22-21- |
| InChIKey | FDKMYEWKMSMJKL-DQRAZIAOSA-N |
| XLogP | 3.69 |
| TPSA | 154.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|