C14H16N2O7 — CID 119216524
4-(4-ethoxy-3-nitrobenzoyl)morpholine-3-carboxylic acid (PubChem CID 119216524) has the molecular formula C14H16N2O7 and a molecular weight of 324.29 g/mol. Its IUPAC name is 4-(4-ethoxy-3-nitrobenzoyl)morpholine-3-carboxylic acid.
| Compound Name | 4-(4-ethoxy-3-nitrobenzoyl)morpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 119216524 |
| Molecular Formula | C14H16N2O7 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 4-(4-ethoxy-3-nitrobenzoyl)morpholine-3-carboxylic acid |
| SMILES | CCOc1ccc(C(=O)N2CCOCC2C(=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H16N2O7/c1-2-23-12-4-3-9(7-10(12)16(20)21)13(17)15-5-6-22-8-11(15)14(18)19/h3-4,7,11H,2,5-6,8H2,1H3,(H,18,19) |
| InChIKey | DLMKNMWMORRNQZ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|