C14H18N2O6S — CID 119216316
4-[4-(ethylsulfamoyl)benzoyl]morpholine-3-carboxylic acid (PubChem CID 119216316) has the molecular formula C14H18N2O6S and a molecular weight of 342.37 g/mol. Its IUPAC name is 4-[4-(ethylsulfamoyl)benzoyl]morpholine-3-carboxylic acid.
| Compound Name | 4-[4-(ethylsulfamoyl)benzoyl]morpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 119216316 |
| Molecular Formula | C14H18N2O6S |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 4-[4-(ethylsulfamoyl)benzoyl]morpholine-3-carboxylic acid |
| SMILES | CCNS(=O)(=O)c1ccc(C(=O)N2CCOCC2C(=O)O)cc1 |
| InChI | InChI=1S/C14H18N2O6S/c1-2-15-23(20,21)11-5-3-10(4-6-11)13(17)16-7-8-22-9-12(16)14(18)19/h3-6,12,15H,2,7-9H2,1H3,(H,18,19) |
| InChIKey | GOVWKFIJGMQGPD-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |