C17H18N2O7S — CID 119216622
4-[4-(furan-2-ylmethylsulfamoyl)benzoyl]morpholine-3-carboxylic acid (PubChem CID 119216622) has the molecular formula C17H18N2O7S and a molecular weight of 394.41 g/mol. Its IUPAC name is 4-[4-(furan-2-ylmethylsulfamoyl)benzoyl]morpholine-3-carboxylic acid.
| Compound Name | 4-[4-(furan-2-ylmethylsulfamoyl)benzoyl]morpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 119216622 |
| Molecular Formula | C17H18N2O7S |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 4-[4-(furan-2-ylmethylsulfamoyl)benzoyl]morpholine-3-carboxylic acid |
| SMILES | O=C(O)C1COCCN1C(=O)c1ccc(S(=O)(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C17H18N2O7S/c20-16(19-7-9-25-11-15(19)17(21)22)12-3-5-14(6-4-12)27(23,24)18-10-13-2-1-8-26-13/h1-6,8,15,18H,7,9-11H2,(H,21,22) |
| InChIKey | XSQWEOVHDZLOQM-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |