C15H20N2O7S — CID 119216832
4-[4-(2-methoxyethylsulfamoyl)benzoyl]morpholine-3-carboxylic acid (PubChem CID 119216832) has the molecular formula C15H20N2O7S and a molecular weight of 372.40 g/mol. Its IUPAC name is 4-[4-(2-methoxyethylsulfamoyl)benzoyl]morpholine-3-carboxylic acid.
| Compound Name | 4-[4-(2-methoxyethylsulfamoyl)benzoyl]morpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 119216832 |
| Molecular Formula | C15H20N2O7S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 4-[4-(2-methoxyethylsulfamoyl)benzoyl]morpholine-3-carboxylic acid |
| SMILES | COCCNS(=O)(=O)c1ccc(C(=O)N2CCOCC2C(=O)O)cc1 |
| InChI | InChI=1S/C15H20N2O7S/c1-23-8-6-16-25(21,22)12-4-2-11(3-5-12)14(18)17-7-9-24-10-13(17)15(19)20/h2-5,13,16H,6-10H2,1H3,(H,19,20) |
| InChIKey | YZAPYQIPWXCXRM-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|