C15H20N2O6S — CID 119355684
1-[4-(2-methoxyethylsulfamoyl)benzoyl]pyrrolidine-2-carboxylic acid (PubChem CID 119355684) has the molecular formula C15H20N2O6S and a molecular weight of 356.40 g/mol. Its IUPAC name is 1-[4-(2-methoxyethylsulfamoyl)benzoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[4-(2-methoxyethylsulfamoyl)benzoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 119355684 |
| Molecular Formula | C15H20N2O6S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 1-[4-(2-methoxyethylsulfamoyl)benzoyl]pyrrolidine-2-carboxylic acid |
| SMILES | COCCNS(=O)(=O)c1ccc(C(=O)N2CCCC2C(=O)O)cc1 |
| InChI | InChI=1S/C15H20N2O6S/c1-23-10-8-16-24(21,22)12-6-4-11(5-7-12)14(18)17-9-2-3-13(17)15(19)20/h4-7,13,16H,2-3,8-10H2,1H3,(H,19,20) |
| InChIKey | SNOIFPMGHRWLFA-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|