C16H20N2O6S — CID 119365340
(2S)-1-[4-[2-(dimethylamino)-2-oxoethyl]sulfonylbenzoyl]pyrrolidine-2-carboxylic acid (PubChem CID 119365340) has the molecular formula C16H20N2O6S and a molecular weight of 368.41 g/mol. Its IUPAC name is (2S)-1-[4-[2-(dimethylamino)-2-oxoethyl]sulfonylbenzoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[4-[2-(dimethylamino)-2-oxoethyl]sulfonylbenzoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 119365340 |
| Molecular Formula | C16H20N2O6S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | (2S)-1-[4-[2-(dimethylamino)-2-oxoethyl]sulfonylbenzoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CN(C)C(=O)CS(=O)(=O)c1ccc(C(=O)N2CCC[C@H]2C(=O)O)cc1 |
| InChI | InChI=1S/C16H20N2O6S/c1-17(2)14(19)10-25(23,24)12-7-5-11(6-8-12)15(20)18-9-3-4-13(18)16(21)22/h5-8,13H,3-4,9-10H2,1-2H3,(H,21,22)/t13-/m0/s1 |
| InChIKey | NQTOITAQJCSZKJ-ZDUSSCGKSA-N |
| XLogP | 0.24 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |