C22H26ClN7S — CID 108784423
4-[1-(3-chlorophenyl)pyrazolo[5,4-d]pyrimidin-4-yl]-N-cyclohexylpiperazine-1-carbothioamide (PubChem CID 108784423) has the molecular formula C22H26ClN7S and a molecular weight of 456.02 g/mol. Its IUPAC name is 4-[1-(3-chlorophenyl)pyrazolo[5,4-d]pyrimidin-4-yl]-N-cyclohexylpiperazine-1-carbothioamide.
| Compound Name | 4-[1-(3-chlorophenyl)pyrazolo[5,4-d]pyrimidin-4-yl]-N-cyclohexylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 108784423 |
| Molecular Formula | C22H26ClN7S |
| Molecular Weight | 456.02 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 4-[1-(3-chlorophenyl)pyrazolo[5,4-d]pyrimidin-4-yl]-N-cyclohexylpiperazine-1-carbothioamide |
| SMILES | S=C(NC1CCCCC1)N1CCN(c2ncnc3c2cnn3-c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C22H26ClN7S/c23-16-5-4-8-18(13-16)30-21-19(14-26-30)20(24-15-25-21)28-9-11-29(12-10-28)22(31)27-17-6-2-1-3-7-17/h4-5,8,13-15,17H,1-3,6-7,9-12H2,(H,27,31) |
| InChIKey | UTSQEGDWMKSCTN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.02 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|