C17H25N5OS — CID 21062804
N-butyl-4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazine-1-carboxamide (PubChem CID 21062804) has the molecular formula C17H25N5OS and a molecular weight of 347.49 g/mol. Its IUPAC name is N-butyl-4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazine-1-carboxamide.
| Compound Name | N-butyl-4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 21062804 |
| Molecular Formula | C17H25N5OS |
| Molecular Weight | 347.49 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | N-butyl-4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazine-1-carboxamide |
| SMILES | CCCCNC(=O)N1CCN(c2ncnc3sc(CC)cc23)CC1 |
| InChI | InChI=1S/C17H25N5OS/c1-3-5-6-18-17(23)22-9-7-21(8-10-22)15-14-11-13(4-2)24-16(14)20-12-19-15/h11-12H,3-10H2,1-2H3,(H,18,23) |
| InChIKey | YFQQAKZOCBIZAP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|