C15H15F5N4OS — CID 21062625
1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-2,2,3,3,3-pentafluoropropan-1-one (PubChem CID 21062625) has the molecular formula C15H15F5N4OS and a molecular weight of 394.37 g/mol. Its IUPAC name is 1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-2,2,3,3,3-pentafluoropropan-1-one.
| Compound Name | 1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-2,2,3,3,3-pentafluoropropan-1-one |
|---|---|
| PubChem CID | 21062625 |
| Molecular Formula | C15H15F5N4OS |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-2,2,3,3,3-pentafluoropropan-1-one |
| SMILES | CCc1cc2c(N3CCN(C(=O)C(F)(F)C(F)(F)F)CC3)ncnc2s1 |
| InChI | InChI=1S/C15H15F5N4OS/c1-2-9-7-10-11(21-8-22-12(10)26-9)23-3-5-24(6-4-23)13(25)14(16,17)15(18,19)20/h7-8H,2-6H2,1H3 |
| InChIKey | RPUMQVZFMGKNLT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|