C26H29N7OS — CID 142220435
2-[3-(N,2-diaminoanilino)phenyl]-1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]ethanone (PubChem CID 142220435) has the molecular formula C26H29N7OS and a molecular weight of 487.63 g/mol. Its IUPAC name is 2-[3-(N,2-diaminoanilino)phenyl]-1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]ethanone.
| Compound Name | 2-[3-(N,2-diaminoanilino)phenyl]-1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 142220435 |
| Molecular Formula | C26H29N7OS |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | 2-[3-(N,2-diaminoanilino)phenyl]-1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]ethanone |
| SMILES | CCc1cc2c(N3CCN(C(=O)Cc4cccc(N(N)c5ccccc5N)c4)CC3)ncnc2s1 |
| InChI | InChI=1S/C26H29N7OS/c1-2-20-16-21-25(29-17-30-26(21)35-20)32-12-10-31(11-13-32)24(34)15-18-6-5-7-19(14-18)33(28)23-9-4-3-8-22(23)27/h3-9,14,16-17H,2,10-13,15,27-28H2,1H3 |
| InChIKey | NIAVCSBQOQKGFC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 104.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|