C25H29N5OS — CID 21062655
1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-5-indol-1-ylpentan-1-one (PubChem CID 21062655) has the molecular formula C25H29N5OS and a molecular weight of 447.61 g/mol. Its IUPAC name is 1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-5-indol-1-ylpentan-1-one.
| Compound Name | 1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-5-indol-1-ylpentan-1-one |
|---|---|
| PubChem CID | 21062655 |
| Molecular Formula | C25H29N5OS |
| Molecular Weight | 447.61 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-5-indol-1-ylpentan-1-one |
| SMILES | CCc1cc2c(N3CCN(C(=O)CCCCn4ccc5ccccc54)CC3)ncnc2s1 |
| InChI | InChI=1S/C25H29N5OS/c1-2-20-17-21-24(26-18-27-25(21)32-20)30-15-13-29(14-16-30)23(31)9-5-6-11-28-12-10-19-7-3-4-8-22(19)28/h3-4,7-8,10,12,17-18H,2,5-6,9,11,13-16H2,1H3 |
| InChIKey | CYTJRNWQBPWRAG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.61 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|