C21H15N5O3 — CID 57334789
3-[(3-carbamoyl-7-pyrimidin-5-ylquinolin-4-yl)amino]benzoic acid (PubChem CID 57334789) has the molecular formula C21H15N5O3 and a molecular weight of 385.38 g/mol. Its IUPAC name is 3-[(3-carbamoyl-7-pyrimidin-5-ylquinolin-4-yl)amino]benzoic acid.
| Compound Name | 3-[(3-carbamoyl-7-pyrimidin-5-ylquinolin-4-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 57334789 |
| Molecular Formula | C21H15N5O3 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 3-[(3-carbamoyl-7-pyrimidin-5-ylquinolin-4-yl)amino]benzoic acid |
| SMILES | NC(=O)c1cnc2cc(-c3cncnc3)ccc2c1Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C21H15N5O3/c22-20(27)17-10-25-18-7-12(14-8-23-11-24-9-14)4-5-16(18)19(17)26-15-3-1-2-13(6-15)21(28)29/h1-11H,(H2,22,27)(H,25,26)(H,28,29) |
| InChIKey | PMGDZQUVZZQORW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 131.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |