C24H20N4O4 — CID 67513533
methyl 3-[(3-carbamoyl-6-methoxy-7-pyridin-4-ylquinolin-4-yl)amino]benzoate (PubChem CID 67513533) has the molecular formula C24H20N4O4 and a molecular weight of 428.45 g/mol. Its IUPAC name is methyl 3-[(3-carbamoyl-6-methoxy-7-pyridin-4-ylquinolin-4-yl)amino]benzoate.
| Compound Name | methyl 3-[(3-carbamoyl-6-methoxy-7-pyridin-4-ylquinolin-4-yl)amino]benzoate |
|---|---|
| PubChem CID | 67513533 |
| Molecular Formula | C24H20N4O4 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | methyl 3-[(3-carbamoyl-6-methoxy-7-pyridin-4-ylquinolin-4-yl)amino]benzoate |
| SMILES | COC(=O)c1cccc(Nc2c(C(N)=O)cnc3cc(-c4ccncc4)c(OC)cc23)c1 |
| InChI | InChI=1S/C24H20N4O4/c1-31-21-12-18-20(11-17(21)14-6-8-26-9-7-14)27-13-19(23(25)29)22(18)28-16-5-3-4-15(10-16)24(30)32-2/h3-13H,1-2H3,(H2,25,29)(H,27,28) |
| InChIKey | SHTKLMCOWXGEPH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 116.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |