C18H15F2N3O3 — CID 44570972
4-(3,5-difluoroanilino)-6,7-dimethoxyquinoline-3-carboxamide (PubChem CID 44570972) has the molecular formula C18H15F2N3O3 and a molecular weight of 359.33 g/mol. Its IUPAC name is 4-(3,5-difluoroanilino)-6,7-dimethoxyquinoline-3-carboxamide.
| Compound Name | 4-(3,5-difluoroanilino)-6,7-dimethoxyquinoline-3-carboxamide |
|---|---|
| PubChem CID | 44570972 |
| Molecular Formula | C18H15F2N3O3 |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 4-(3,5-difluoroanilino)-6,7-dimethoxyquinoline-3-carboxamide |
| SMILES | COc1cc2ncc(C(N)=O)c(Nc3cc(F)cc(F)c3)c2cc1OC |
| InChI | InChI=1S/C18H15F2N3O3/c1-25-15-6-12-14(7-16(15)26-2)22-8-13(18(21)24)17(12)23-11-4-9(19)3-10(20)5-11/h3-8H,1-2H3,(H2,21,24)(H,22,23) |
| InChIKey | SIJSEVYTHQJYDJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |