C25H22N4O3 — CID 67514120
ethyl 3-[[3-carbamoyl-7-(4-methyl-3-pyridinyl)quinolin-4-yl]amino]benzoate (PubChem CID 67514120) has the molecular formula C25H22N4O3 and a molecular weight of 426.48 g/mol. Its IUPAC name is ethyl 3-[[3-carbamoyl-7-(4-methyl-3-pyridinyl)quinolin-4-yl]amino]benzoate.
| Compound Name | ethyl 3-[[3-carbamoyl-7-(4-methyl-3-pyridinyl)quinolin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 67514120 |
| Molecular Formula | C25H22N4O3 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | ethyl 3-[[3-carbamoyl-7-(4-methyl-3-pyridinyl)quinolin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(Nc2c(C(N)=O)cnc3cc(-c4cnccc4C)ccc23)c1 |
| InChI | InChI=1S/C25H22N4O3/c1-3-32-25(31)17-5-4-6-18(11-17)29-23-19-8-7-16(20-13-27-10-9-15(20)2)12-22(19)28-14-21(23)24(26)30/h4-14H,3H2,1-2H3,(H2,26,30)(H,28,29) |
| InChIKey | QVGDONBGNKHOCL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |