C24H21N5O6 — CID 67517922
ethyl 3-[[7-(2,4-dimethoxypyrimidin-5-yl)-3-nitroquinolin-4-yl]amino]benzoate (PubChem CID 67517922) has the molecular formula C24H21N5O6 and a molecular weight of 475.46 g/mol. Its IUPAC name is ethyl 3-[[7-(2,4-dimethoxypyrimidin-5-yl)-3-nitroquinolin-4-yl]amino]benzoate.
| Compound Name | ethyl 3-[[7-(2,4-dimethoxypyrimidin-5-yl)-3-nitroquinolin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 67517922 |
| Molecular Formula | C24H21N5O6 |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | ethyl 3-[[7-(2,4-dimethoxypyrimidin-5-yl)-3-nitroquinolin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(Nc2c([N+](=O)[O-])cnc3cc(-c4cnc(OC)nc4OC)ccc23)c1 |
| InChI | InChI=1S/C24H21N5O6/c1-4-35-23(30)15-6-5-7-16(10-15)27-21-17-9-8-14(11-19(17)25-13-20(21)29(31)32)18-12-26-24(34-3)28-22(18)33-2/h5-13H,4H2,1-3H3,(H,25,27) |
| InChIKey | JWUHSSPPSHWYAZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 138.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|