C30H29N5O4 — CID 156535535
[4-[[4-(4-anilino-3-carbamoylquinolin-6-yl)benzoyl]amino]cyclohexyl]carbamic acid (PubChem CID 156535535) has the molecular formula C30H29N5O4 and a molecular weight of 523.59 g/mol. Its IUPAC name is [4-[[4-(4-anilino-3-carbamoylquinolin-6-yl)benzoyl]amino]cyclohexyl]carbamic acid.
| Compound Name | [4-[[4-(4-anilino-3-carbamoylquinolin-6-yl)benzoyl]amino]cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 156535535 |
| Molecular Formula | C30H29N5O4 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | [4-[[4-(4-anilino-3-carbamoylquinolin-6-yl)benzoyl]amino]cyclohexyl]carbamic acid |
| SMILES | NC(=O)c1cnc2ccc(-c3ccc(C(=O)NC4CCC(NC(=O)O)CC4)cc3)cc2c1Nc1ccccc1 |
| InChI | InChI=1S/C30H29N5O4/c31-28(36)25-17-32-26-15-10-20(16-24(26)27(25)33-21-4-2-1-3-5-21)18-6-8-19(9-7-18)29(37)34-22-11-13-23(14-12-22)35-30(38)39/h1-10,15-17,22-23,35H,11-14H2,(H2,31,36)(H,32,33)(H,34,37)(H,38,39) |
| InChIKey | RBAPRYANPDIZDJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 146.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |