C26H23FN4O2 — CID 156547219
4-anilino-N-ethyl-6-[3-fluoro-4-(methylcarbamoyl)phenyl]quinoline-3-carboxamide (PubChem CID 156547219) has the molecular formula C26H23FN4O2 and a molecular weight of 442.49 g/mol. Its IUPAC name is 4-anilino-N-ethyl-6-[3-fluoro-4-(methylcarbamoyl)phenyl]quinoline-3-carboxamide.
| Compound Name | 4-anilino-N-ethyl-6-[3-fluoro-4-(methylcarbamoyl)phenyl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 156547219 |
| Molecular Formula | C26H23FN4O2 |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 4-anilino-N-ethyl-6-[3-fluoro-4-(methylcarbamoyl)phenyl]quinoline-3-carboxamide |
| SMILES | CCNC(=O)c1cnc2ccc(-c3ccc(C(=O)NC)c(F)c3)cc2c1Nc1ccccc1 |
| InChI | InChI=1S/C26H23FN4O2/c1-3-29-26(33)21-15-30-23-12-10-16(17-9-11-19(22(27)14-17)25(32)28-2)13-20(23)24(21)31-18-7-5-4-6-8-18/h4-15H,3H2,1-2H3,(H,28,32)(H,29,33)(H,30,31) |
| InChIKey | LWWIPNYTYVXANI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |