C15H14FN3O3 — CID 53224372
2-amino-5-[4-(ethylcarbamoyl)-3-fluorophenyl]pyridine-4-carboxylic acid (PubChem CID 53224372) has the molecular formula C15H14FN3O3 and a molecular weight of 303.29 g/mol. Its IUPAC name is 2-amino-5-[4-(ethylcarbamoyl)-3-fluorophenyl]pyridine-4-carboxylic acid.
| Compound Name | 2-amino-5-[4-(ethylcarbamoyl)-3-fluorophenyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 53224372 |
| Molecular Formula | C15H14FN3O3 |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 2-amino-5-[4-(ethylcarbamoyl)-3-fluorophenyl]pyridine-4-carboxylic acid |
| SMILES | CCNC(=O)c1ccc(-c2cnc(N)cc2C(=O)O)cc1F |
| InChI | InChI=1S/C15H14FN3O3/c1-2-18-14(20)9-4-3-8(5-12(9)16)11-7-19-13(17)6-10(11)15(21)22/h3-7H,2H2,1H3,(H2,17,19)(H,18,20)(H,21,22) |
| InChIKey | PJCNOFUMXIBJME-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |