C16H12F2NO3- — CID 86307324
3-[4-(ethylcarbamoyl)-3-fluorophenyl]-4-fluorobenzoate (PubChem CID 86307324) has the molecular formula C16H12F2NO3- and a molecular weight of 304.27 g/mol. Its IUPAC name is 3-[4-(ethylcarbamoyl)-3-fluorophenyl]-4-fluorobenzoate.
| Compound Name | 3-[4-(ethylcarbamoyl)-3-fluorophenyl]-4-fluorobenzoate |
|---|---|
| PubChem CID | 86307324 |
| Molecular Formula | C16H12F2NO3- |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 3-[4-(ethylcarbamoyl)-3-fluorophenyl]-4-fluorobenzoate |
| SMILES | CCNC(=O)c1ccc(-c2cc(C(=O)[O-])ccc2F)cc1F |
| InChI | InChI=1S/C16H13F2NO3/c1-2-19-15(20)11-5-3-9(8-14(11)18)12-7-10(16(21)22)4-6-13(12)17/h3-8H,2H2,1H3,(H,19,20)(H,21,22)/p-1 |
| InChIKey | ZBCMEMCAMPNWSE-UHFFFAOYSA-M |
| XLogP | 1.75 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |