C23H28N4O — CID 156631271
4-anilino-6-(hexylamino)-N-methylquinoline-3-carboxamide (PubChem CID 156631271) has the molecular formula C23H28N4O and a molecular weight of 376.50 g/mol. Its IUPAC name is 4-anilino-6-(hexylamino)-N-methylquinoline-3-carboxamide.
| Compound Name | 4-anilino-6-(hexylamino)-N-methylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 156631271 |
| Molecular Formula | C23H28N4O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 4-anilino-6-(hexylamino)-N-methylquinoline-3-carboxamide |
| SMILES | CCCCCCNc1ccc2ncc(C(=O)NC)c(Nc3ccccc3)c2c1 |
| InChI | InChI=1S/C23H28N4O/c1-3-4-5-9-14-25-18-12-13-21-19(15-18)22(20(16-26-21)23(28)24-2)27-17-10-7-6-8-11-17/h6-8,10-13,15-16,25H,3-5,9,14H2,1-2H3,(H,24,28)(H,26,27) |
| InChIKey | VPTGXKPVJHDKIV-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|