C17H14N4O5 — CID 3859104
ethyl 4-(2-hydroxy-5-nitroanilino)quinazoline-2-carboxylate (PubChem CID 3859104) has the molecular formula C17H14N4O5 and a molecular weight of 354.32 g/mol. Its IUPAC name is ethyl 4-(2-hydroxy-5-nitroanilino)quinazoline-2-carboxylate.
| Compound Name | ethyl 4-(2-hydroxy-5-nitroanilino)quinazoline-2-carboxylate |
|---|---|
| PubChem CID | 3859104 |
| Molecular Formula | C17H14N4O5 |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | ethyl 4-(2-hydroxy-5-nitroanilino)quinazoline-2-carboxylate |
| SMILES | CCOC(=O)c1nc(Nc2cc([N+](=O)[O-])ccc2O)c2ccccc2n1 |
| InChI | InChI=1S/C17H14N4O5/c1-2-26-17(23)16-18-12-6-4-3-5-11(12)15(20-16)19-13-9-10(21(24)25)7-8-14(13)22/h3-9,22H,2H2,1H3,(H,18,19,20) |
| InChIKey | VLKGHQOUINWHIB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 127.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|