C14H18N2O2S2 — CID 43508090
N-[4-[1-(ethylamino)ethyl]phenyl]thiophene-2-sulfonamide (PubChem CID 43508090) has the molecular formula C14H18N2O2S2 and a molecular weight of 310.44 g/mol. Its IUPAC name is N-[4-[1-(ethylamino)ethyl]phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[4-[1-(ethylamino)ethyl]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 43508090 |
| Molecular Formula | C14H18N2O2S2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | N-[4-[1-(ethylamino)ethyl]phenyl]thiophene-2-sulfonamide |
| SMILES | CCNC(C)c1ccc(NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C14H18N2O2S2/c1-3-15-11(2)12-6-8-13(9-7-12)16-20(17,18)14-5-4-10-19-14/h4-11,15-16H,3H2,1-2H3 |
| InChIKey | RVDDGCVSPSZQGK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |