C14H18N2O5S3 — CID 42998818
N-[4-(1-methoxypropan-2-ylsulfamoyl)phenyl]thiophene-2-sulfonamide (PubChem CID 42998818) has the molecular formula C14H18N2O5S3 and a molecular weight of 390.51 g/mol. Its IUPAC name is N-[4-(1-methoxypropan-2-ylsulfamoyl)phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[4-(1-methoxypropan-2-ylsulfamoyl)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 42998818 |
| Molecular Formula | C14H18N2O5S3 |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | N-[4-(1-methoxypropan-2-ylsulfamoyl)phenyl]thiophene-2-sulfonamide |
| SMILES | COCC(C)NS(=O)(=O)c1ccc(NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C14H18N2O5S3/c1-11(10-21-2)15-23(17,18)13-7-5-12(6-8-13)16-24(19,20)14-4-3-9-22-14/h3-9,11,15-16H,10H2,1-2H3 |
| InChIKey | JVEWAPQUCAJYNH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |