C20H18N4O2S2 — CID 1399792
N-[3-(2,5-dimethylanilino)quinoxalin-2-yl]thiophene-2-sulfonamide (PubChem CID 1399792) has the molecular formula C20H18N4O2S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is N-[3-(2,5-dimethylanilino)quinoxalin-2-yl]thiophene-2-sulfonamide.
| Compound Name | N-[3-(2,5-dimethylanilino)quinoxalin-2-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 1399792 |
| Molecular Formula | C20H18N4O2S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | N-[3-(2,5-dimethylanilino)quinoxalin-2-yl]thiophene-2-sulfonamide |
| SMILES | Cc1ccc(C)c(Nc2nc3ccccc3nc2NS(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C20H18N4O2S2/c1-13-9-10-14(2)17(12-13)23-19-20(22-16-7-4-3-6-15(16)21-19)24-28(25,26)18-8-5-11-27-18/h3-12H,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | JLZZEKIBXHLLDH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |