C20H17N5O3S — CID 136598761
N-[3-[4-(hydroxyamino)anilino]quinoxalin-2-yl]benzenesulfonamide (PubChem CID 136598761) has the molecular formula C20H17N5O3S and a molecular weight of 407.46 g/mol. Its IUPAC name is N-[3-[4-(hydroxyamino)anilino]quinoxalin-2-yl]benzenesulfonamide.
| Compound Name | N-[3-[4-(hydroxyamino)anilino]quinoxalin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 136598761 |
| Molecular Formula | C20H17N5O3S |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | N-[3-[4-(hydroxyamino)anilino]quinoxalin-2-yl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nc2ccccc2nc1Nc1ccc(NO)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H17N5O3S/c26-24-15-12-10-14(11-13-15)21-19-20(23-18-9-5-4-8-17(18)22-19)25-29(27,28)16-6-2-1-3-7-16/h1-13,24,26H,(H,21,22)(H,23,25) |
| InChIKey | DIBJIXNNFIZZEK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 116.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|