C24H20N4O5S — CID 58274233
4-[4-[[3-(benzenesulfonamido)quinoxalin-2-yl]amino]phenyl]-4-oxobutanoic acid (PubChem CID 58274233) has the molecular formula C24H20N4O5S and a molecular weight of 476.51 g/mol. Its IUPAC name is 4-[4-[[3-(benzenesulfonamido)quinoxalin-2-yl]amino]phenyl]-4-oxobutanoic acid.
| Compound Name | 4-[4-[[3-(benzenesulfonamido)quinoxalin-2-yl]amino]phenyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 58274233 |
| Molecular Formula | C24H20N4O5S |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 4-[4-[[3-(benzenesulfonamido)quinoxalin-2-yl]amino]phenyl]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)c1ccc(Nc2nc3ccccc3nc2NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20N4O5S/c29-21(14-15-22(30)31)16-10-12-17(13-11-16)25-23-24(27-20-9-5-4-8-19(20)26-23)28-34(32,33)18-6-2-1-3-7-18/h1-13H,14-15H2,(H,25,26)(H,27,28)(H,30,31) |
| InChIKey | YOJFSRQPZBYBPN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 138.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |