C22H20ClN5O4S3 — CID 3963778
5-chloro-N-[3-(3-pyrrolidin-1-ylsulfonylanilino)quinoxalin-2-yl]thiophene-2-sulfonamide (PubChem CID 3963778) has the molecular formula C22H20ClN5O4S3 and a molecular weight of 550.09 g/mol. Its IUPAC name is 5-chloro-N-[3-(3-pyrrolidin-1-ylsulfonylanilino)quinoxalin-2-yl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[3-(3-pyrrolidin-1-ylsulfonylanilino)quinoxalin-2-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 3963778 |
| Molecular Formula | C22H20ClN5O4S3 |
| Molecular Weight | 550.09 g/mol |
| Exact Mass | 549.04 |
| IUPAC Name | 5-chloro-N-[3-(3-pyrrolidin-1-ylsulfonylanilino)quinoxalin-2-yl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1nc2ccccc2nc1Nc1cccc(S(=O)(=O)N2CCCC2)c1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C22H20ClN5O4S3/c23-19-10-11-20(33-19)34(29,30)27-22-21(25-17-8-1-2-9-18(17)26-22)24-15-6-5-7-16(14-15)35(31,32)28-12-3-4-13-28/h1-2,5-11,14H,3-4,12-13H2,(H,24,25)(H,26,27) |
| InChIKey | ROINCIMLQJZYRL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.09 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |