C10H11ClN2O3S2 — CID 136512208
5-chloro-N-(5-propan-2-yl-1,2-oxazol-3-yl)thiophene-2-sulfonamide (PubChem CID 136512208) has the molecular formula C10H11ClN2O3S2 and a molecular weight of 306.80 g/mol. Its IUPAC name is 5-chloro-N-(5-propan-2-yl-1,2-oxazol-3-yl)thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-(5-propan-2-yl-1,2-oxazol-3-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 136512208 |
| Molecular Formula | C10H11ClN2O3S2 |
| Molecular Weight | 306.80 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | 5-chloro-N-(5-propan-2-yl-1,2-oxazol-3-yl)thiophene-2-sulfonamide |
| SMILES | CC(C)c1cc(NS(=O)(=O)c2ccc(Cl)s2)no1 |
| InChI | InChI=1S/C10H11ClN2O3S2/c1-6(2)7-5-9(12-16-7)13-18(14,15)10-4-3-8(11)17-10/h3-6H,1-2H3,(H,12,13) |
| InChIKey | MLIBLHPSRDADRR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.80 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |